On Target PR_HIV1 0.2881356/CHEMBL450294
For the given ligand 222, we have found in our database that, being scored 0.2881356, the most similar ligand is CHEMBL450294. Check out the elaboration below.
| 222 (Given Ligand) | CHEMBL450294 (Similar Ligand) |
|---|---|
| CC(=O)NC1C(O)OC(CO)C(O)C1O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCN(C)CCOC2)cc1 |
|
|
|
|
|
|
| 00000000 01005000 00100000 80010500 803800c0 00000000 00002800 20000000 00000000 010000a0 00200000 40018000 00008002 03800000 00001008 00299008 10000000 00000000 11c02000 00000201 00000020 10140600 17000080 08100018 10000401 00000000 00800200 30000021 00000200 00040001 00a00000 00000a00 | 00000010 01c05409 2110050a 81b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e81009 001b0008 10022000 02080000 01400800 01027603 80000120 18280c90 17100040 d9500058 12000400 8000000e 00800000 102000ed 04000600 20060013 80000000 00012670 |