On Target PLP_SARS 0.30201343/CHEMBL213054
For the given ligand 222, we have found in our database that, being scored 0.30201343, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| 222 (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| CC(=O)NC1C(O)OC(CO)C(O)C1O | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000000 01005000 00100000 80010500 803800c0 00000000 00002800 20000000 00000000 010000a0 00200000 40018000 00008002 03800000 00001008 00299008 10000000 00000000 11c02000 00000201 00000020 10140600 17000080 08100018 10000401 00000000 00800200 30000021 00000200 00040001 00a00000 00000a00 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |