On Target ACE2_HUMAN 0.29896906/CHEMBL254900
For the given ligand 1, we have found in our database that, being scored 0.29896906, the most similar ligand is CHEMBL254900. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL254900 (Similar Ligand) |
|---|---|
| CC(=O)NC1C(O)OC(CO)C(O)C1O | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](C)C(=O)O |
|
|
|
|
|
|
| 00000000 01005000 00100000 80010500 803800c0 00000000 00002800 20000000 00000000 010000a0 00200000 40018000 00008002 03800000 00001008 00299008 10000000 00000000 11c02000 00000201 00000020 10140600 17000080 08100018 10000401 00000000 00800200 30000021 00000200 00040001 00a00000 00000a00 | 00010000 01004000 00100000 00100400 00000080 00000000 80000000 20000000 00000000 02080080 00200000 40013000 06008002 00040000 80080000 00080008 10000000 00000000 00000000 00000201 00000000 10000e00 03000100 04100018 00000000 00000000 00000000 10000040 00000000 00040001 20004000 03010200 |