On Target NS3_HCV1B 0.27322406/CHEMBL3954962
For the given ligand 1, we have found in our database that, being scored 0.27322406, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| CC(=O)NC1C(O)OC(CO)C(O)C1O | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00000000 01005000 00100000 80010500 803800c0 00000000 00002800 20000000 00000000 010000a0 00200000 40018000 00008002 03800000 00001008 00299008 10000000 00000000 11c02000 00000201 00000020 10140600 17000080 08100018 10000401 00000000 00800200 30000021 00000200 00040001 00a00000 00000a00 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |