On Target NA_INFB 0.63366336/CHEMBL183817
For the given ligand 1, we have found in our database that, being scored 0.63366336, the most similar ligand is CHEMBL183817. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL183817 (Similar Ligand) |
|---|---|
| CC(=O)NC1C(O)OC(CO)C(O)C1O | COC(=O)[C@@H]1C[C@H](C(=O)O)O[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00000000 01005000 00100000 80010500 803800c0 00000000 00002800 20000000 00000000 010000a0 00200000 40018000 00008002 03800000 00001008 00299008 10000000 00000000 11c02000 00000201 00000020 10140600 17000080 08100018 10000401 00000000 00800200 30000021 00000200 00040001 00a00000 00000a00 | 00070040 01005000 00100000 80010500 003c00c0 00200000 00000000 20000000 00000000 01020080 00200000 4001d000 1400802a 03800000 00081008 18099008 10820000 80000100 11402000 00000201 00000020 10040e10 17000000 0810001c 10000400 00000000 00800200 10000021 00000200 00040001 00020000 00800a00 |