On Target NS3_HCV1A 0.2060606/CHEMBL3645757
For the given ligand 5H, we have found in our database that, being scored 0.2060606, the most similar ligand is CHEMBL3645757. Check out the elaboration below.
| 5H (Given Ligand) | CHEMBL3645757 (Similar Ligand) |
|---|---|
| O=Cc1ccc(CO)o1 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cc3ccccc3o1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00000000 00200800 00080101 40040200 00000000 00004000 00000400 00240000 02004100 00000000 00002020 40002008 40008400 00000000 00000020 00080008 00004000 02000000 00000000 00000000 00000000 08040200 00000000 00480204 20000040 20000000 04000010 08000000 00000081 00020000 c0000000 00000000 | 000180a0 09203800 06180100 05210600 04000200 00000010 000a0000 62201608 12004100 0013c9c8 00602030 4001b000 46018c1a 01002099 a0400420 00000000 04004000 02000000 46012000 00004201 00000000 38068638 00000003 32d8023c 08800020 e0000000 04100014 98000010 08002180 c1060081 e4064004 00012260 |