On Target ACE2_HUMAN 0.12230216/CHEMBL251809
For the given ligand 5H, we have found in our database that, being scored 0.12230216, the most similar ligand is CHEMBL251809. Check out the elaboration below.
| 5H (Given Ligand) | CHEMBL251809 (Similar Ligand) |
|---|---|
| O=Cc1ccc(CO)o1 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(OCc2ccc(C(F)(F)F)cc2)cc1)C(=O)O |
|
|
|
|
|
|
| 00000000 00200800 00080101 40040200 00000000 00004000 00000400 00240000 02004100 00000000 00002020 40002008 40008400 00000000 00000020 00080008 00004000 02000000 00000000 00000000 00000000 08040200 00000000 00480204 20000040 20000000 04000010 08000000 00000081 00020000 c0000000 00000000 | 04010000 01005008 20100108 00150600 00001080 00004000 82040400 20000004 00000980 020a08d0 08300000 4001b000 06808002 01050000 81080001 02080008 10000000 02000000 00400008 00020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00120100 90000040 04000200 00060003 60104000 03012600 |