On Target PA_INFA 0.17582418/CHEMBL1829211
For the given ligand 5H, we have found in our database that, being scored 0.17582418, the most similar ligand is CHEMBL1829211. Check out the elaboration below.
| 5H (Given Ligand) | CHEMBL1829211 (Similar Ligand) |
|---|---|
| O=Cc1ccc(CO)o1 | O=C(O)/C(O)=C/C(=O)c1ccc(-c2ccccc2)cc1 |
|
|
|
|
|
|
| 00000000 00200800 00080101 40040200 00000000 00004000 00000400 00240000 02004100 00000000 00002020 40002008 40008400 00000000 00000020 00080008 00004000 02000000 00000000 00000000 00000000 08040200 00000000 00480204 20000040 20000000 04000010 08000000 00000081 00020000 c0000000 00000000 | 00002000 00000800 00000100 40010200 00000000 00800000 00000001 00000400 01000100 00980840 08000000 4000c800 80008000 00000000 00000000 00080008 00020400 02100000 04250010 10000800 00000000 18020a80 14008000 00400014 00001000 84004400 00400000 00000040 00004000 00020002 84000000 00000400 |