On Target PR_HIV1 0.08196721/CHEMBL3645129
For the given ligand 5H, we have found in our database that, being scored 0.08196721, the most similar ligand is CHEMBL3645129. Check out the elaboration below.
| 5H (Given Ligand) | CHEMBL3645129 (Similar Ligand) |
|---|---|
| O=Cc1ccc(CO)o1 | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1CC2OCO[C@@H]2C1)S(=O)(=O)c1ccc(CO)cc1 |
|
|
|
|
|
|
| 00000000 00200800 00080101 40040200 00000000 00004000 00000400 00240000 02004100 00000000 00002020 40002008 40008400 00000000 00000020 00080008 00004000 02000000 00000000 00000000 00000000 08040200 00000000 00480204 20000040 20000000 04000010 08000000 00000081 00020000 c0000000 00000000 | 00000010 01c05400 01100102 01b10700 00280088 0002c004 00000800 a8000004 00740b00 014809e0 08302000 60018000 00008002 02200101 80e80000 003a0008 10822000 02080000 11408800 01007603 80000100 18380cb0 07100040 d9500058 02000000 8000100e 00000000 3420002c 04000600 2106001b c0a00000 00012670 |