On Target NS5B_HCV1B 0.12446352/CHEMBL3645188
For the given ligand 5H, we have found in our database that, being scored 0.12446352, the most similar ligand is CHEMBL3645188. Check out the elaboration below.
| 5H (Given Ligand) | CHEMBL3645188 (Similar Ligand) |
|---|---|
| O=Cc1ccc(CO)o1 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3ccoc3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00000000 00200800 00080101 40040200 00000000 00004000 00000400 00240000 02004100 00000000 00002020 40002008 40008400 00000000 00000020 00080008 00004000 02000000 00000000 00000000 00000000 08040200 00000000 00480204 20000040 20000000 04000010 08000000 00000081 00020000 c0000000 00000000 | 00004006 00a0de08 20180902 41310e00 210c0001 00004042 02050000 02201418 00124900 004909e0 0d312024 40118c00 c0008c33 01400201 c08a4440 200e200e 04268000 02030004 08600008 00225203 e0100101 1c8b8e3e 2080c800 9368001c 02104084 c0004048 00670090 8880108c 0c488104 0046005b e4048088 a81147e0 |