On Target NA_INFB 0.0955414/CHEMBL365976
For the given ligand 5H, we have found in our database that, being scored 0.0955414, the most similar ligand is CHEMBL365976. Check out the elaboration below.
| 5H (Given Ligand) | CHEMBL365976 (Similar Ligand) |
|---|---|
| O=Cc1ccc(CO)o1 | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1ccon1 |
|
|
|
|
|
|
| 00000000 00200800 00080101 40040200 00000000 00004000 00000400 00240000 02004100 00000000 00002020 40002008 40008400 00000000 00000020 00080008 00004000 02000000 00000000 00000000 00000000 08040200 00000000 00480204 20000040 20000000 04000010 08000000 00000081 00020000 c0000000 00000000 | 04010000 01003200 001a0102 2600c600 00080680 00100010 00000020 20040408 00020880 00080080 00308000 40013000 0600801a 01a03041 81180000 200c000c 11000200 0e010002 00402000 00800201 00902006 30240e30 03800001 03180098 00000000 00000000 00000020 18000181 0c200006 0006000b 00024000 40c02e00 |