On Target NP_HCoV-OC43 0.078431375/CHEMBL3233481
For the given ligand 5H, we have found in our database that, being scored 0.078431375, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| 5H (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| O=Cc1ccc(CO)o1 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000000 00200800 00080101 40040200 00000000 00004000 00000400 00240000 02004100 00000000 00002020 40002008 40008400 00000000 00000020 00080008 00004000 02000000 00000000 00000000 00000000 08040200 00000000 00480204 20000040 20000000 04000010 08000000 00000081 00020000 c0000000 00000000 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |