On Target PLP_SARS 0.35714287/CHEMBL222234
For the given ligand 5H, we have found in our database that, being scored 0.35714287, the most similar ligand is CHEMBL222234. Check out the elaboration below.
| 5H (Given Ligand) | CHEMBL222234 (Similar Ligand) |
|---|---|
| O=Cc1ccc(CO)o1 | O=C(Oc1cncc(Br)c1)c1ccco1 |
|
|
|
|
|
|
| 00000000 00200800 00080101 40040200 00000000 00004000 00000400 00240000 02004100 00000000 00002020 40002008 40008400 00000000 00000020 00080008 00004000 02000000 00000000 00000000 00000000 08040200 00000000 00480204 20000040 20000000 04000010 08000000 00000081 00020000 c0000000 00000000 | 0410c002 00208808 60084109 00000200 00041000 04004006 00080000 00200001 02004100 20000040 00000124 4004a000 60808c24 08010000 01030020 020c000c 00124000 02002000 00200000 00020040 40000000 08048a00 30800000 00c89204 20002440 20082180 04020210 08000000 00000281 00020000 c0005008 18000000 |