On Target PR_SARS 0.14124294/CHEMBL2441741
For the given ligand Luteolin, we have found in our database that, being scored 0.14124294, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Luteolin (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| O=c2cc(c1ccc(O)c(O)c1)oc3cc(O)cc(O)c23 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00402001 40200018 20080100 00110200 00000200 80004020 02000000 40800200 02084100 40000840 00000010 41008000 40008412 00200088 00000020 00008208 00064040 02000840 0e000200 00821a00 00240000 08000828 10000000 00580000 08000000 80000000 040200b4 08100040 00006000 01820800 40000040 00000000 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |