On Target ACE2_HUMAN 0.2080537/CHEMBL254495
For the given ligand Harmony_1, we have found in our database that, being scored 0.2080537, the most similar ligand is CHEMBL254495. Check out the elaboration below.
| Harmony_1 (Given Ligand) | CHEMBL254495 (Similar Ligand) |
|---|---|
| O=c2[nH]c(c1cccc(O)c1)nc3ccccc23 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc(OCc2ccccc2)c1)C(=O)O |
|
|
|
|
|
|
| 00000002 40000008 20000100 10810600 00040020 00004020 02001800 00080000 06000100 50000860 01000004 40008000 00008002 00600000 00020040 020c000c 00000020 0200a000 00600000 00422200 40000000 08000028 20800040 00500000 00000002 80000000 20000000 00040000 00004004 00420400 40000800 40000080 | 04010000 43005008 20100108 00110600 00001080 c0004000 82000000 20000004 00000980 020a08c0 08300000 4001b000 06808002 20050080 81080001 02080008 10000000 02000000 00480008 00020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00000000 10000040 04000200 00060003 60004000 03012600 |