On Target PA_INFA 0.34013605/CHEMBL2443239
For the given ligand Harmony_1, we have found in our database that, being scored 0.34013605, the most similar ligand is CHEMBL2443239. Check out the elaboration below.
| Harmony_1 (Given Ligand) | CHEMBL2443239 (Similar Ligand) |
|---|---|
| O=c2[nH]c(c1cccc(O)c1)nc3ccccc23 | O=c1[nH]c(-c2ccc(F)cc2)c(-c2ccc(-c3nnn[nH]3)cc2)cc1O |
|
|
|
|
|
|
| 00000002 40000008 20000100 10810600 00040020 00004020 02001800 00080000 06000100 50000860 01000004 40008000 00008002 00600000 00020040 020c000c 00000020 0200a000 00600000 00422200 40000000 08000028 20800040 00500000 00000002 80000000 20000000 00040000 00004004 00420400 40000800 40000080 | 00002002 40000019 60104100 12010210 01841028 0400005c 00800800 00280000 06000100 50000860 04008084 40008000 00018894 00201001 20120000 820c200c 00020060 02002804 04200000 10721002 40060120 88008000 3080c000 00504400 00042403 c0280000 18020240 00000041 00404004 00028400 80000a00 08000200 |