On Target PR_HIV1 0.15706806/CHEMBL523528
For the given ligand Harmony_1, we have found in our database that, being scored 0.15706806, the most similar ligand is CHEMBL523528. Check out the elaboration below.
| Harmony_1 (Given Ligand) | CHEMBL523528 (Similar Ligand) |
|---|---|
| O=c2[nH]c(c1cccc(O)c1)nc3ccccc23 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCOC2)cc1 |
|
|
|
|
|
|
| 00000002 40000008 20000100 10810600 00040020 00004020 02001800 00080000 06000100 50000860 01000004 40008000 00008002 00600000 00020040 020c000c 00000020 0200a000 00600000 00422200 40000000 08000028 20800040 00500000 00000002 80000000 20000000 00040000 00004004 00420400 40000800 40000080 | 00000010 01c05409 2110050a 01b10600 00081080 00028000 02802800 20000004 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a0008 10022000 02080000 01400800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000000e 00800000 342000cc 04000600 20060013 80000000 00012670 |