On Target RT_HIV1 0.2777778/CHEMBL4291913
For the given ligand Harmony_1, we have found in our database that, being scored 0.2777778, the most similar ligand is CHEMBL4291913. Check out the elaboration below.
| Harmony_1 (Given Ligand) | CHEMBL4291913 (Similar Ligand) |
|---|---|
| O=c2[nH]c(c1cccc(O)c1)nc3ccccc23 | O=c1cc(Nc2cccc(-c3ccc(Cl)cc3)c2)[nH]c(=O)n1O |
|
|
|
|
|
|
| 00000002 40000008 20000100 10810600 00040020 00004020 02001800 00080000 06000100 50000860 01000004 40008000 00008002 00600000 00020040 020c000c 00000020 0200a000 00600000 00422200 40000000 08000028 20800040 00500000 00000002 80000000 20000000 00040000 00004004 00420400 40000800 40000080 | 0100a002 00400000 00000108 4a090600 00000000 00004100 00009010 40000800 06002100 00000870 04300004 40049800 07008004 004000c0 002000c0 000c0414 00060040 1201c000 0c40000a 10200000 41802000 08060100 30804040 00d00000 00042000 c0080000 22040240 000400e0 0040c008 00460000 40000000 010200c0 |