On Target NS5B_HCV1B 0.22222222/CHEMBL99408
For the given ligand Harmony_1, we have found in our database that, being scored 0.22222222, the most similar ligand is CHEMBL99408. Check out the elaboration below.
| Harmony_1 (Given Ligand) | CHEMBL99408 (Similar Ligand) |
|---|---|
| O=c2[nH]c(c1cccc(O)c1)nc3ccccc23 | Nc1ccc2ncccc2c1 |
|
|
|
|
|
|
| 00000002 40000008 20000100 10810600 00040020 00004020 02001800 00080000 06000100 50000860 01000004 40008000 00008002 00600000 00020040 020c000c 00000020 0200a000 00600000 00422200 40000000 08000028 20800040 00500000 00000002 80000000 20000000 00040000 00004004 00420400 40000800 40000080 | 00000002 00800000 00004000 00000200 00040000 00000000 00000000 00000000 00000000 00000840 00000004 00008000 00000800 00400000 00000040 00040004 00000000 00000008 00200000 00000000 40000000 08008008 20800000 80000000 00000000 00000000 00000000 00000000 00000000 00060000 00040000 00000000 |