On Target PLP_SARS 0.2923077/CHEMBL222735
For the given ligand Harmony_1, we have found in our database that, being scored 0.2923077, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| Harmony_1 (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| O=c2[nH]c(c1cccc(O)c1)nc3ccccc23 | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 00000002 40000008 20000100 10810600 00040020 00004020 02001800 00080000 06000100 50000860 01000004 40008000 00008002 00600000 00020040 020c000c 00000020 0200a000 00600000 00422200 40000000 08000028 20800040 00500000 00000002 80000000 20000000 00040000 00004004 00420400 40000800 40000080 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |