On Target NS3_HCV1A 0.35036495/CHEMBL3939896
For the given ligand 617, we have found in our database that, being scored 0.35036495, the most similar ligand is CHEMBL3939896. Check out the elaboration below.
| 617 (Given Ligand) | CHEMBL3939896 (Similar Ligand) |
|---|---|
| Cc1ccc(N)cc1C(=O)NC(C)c2cccc3ccccc23 | CC[C@H](NC(=O)CCN)c1ccc(Cl)c(C(=O)c2cccnc2)c1F |
|
|
|
|
|
|
| 10000002 00800800 00000100 10010600 00000000 00008000 00000000 02001000 00800000 00080840 08200004 40008000 00008802 00200000 00000440 10000000 00002000 02000000 00000000 00000000 c0020000 08028608 20000000 0040001c 00040000 c0000000 00004000 80000000 00400100 00060003 80040000 00000600 | 080080c2 00805c00 00104100 02010610 00041201 00000010 30002000 03001000 00400800 00080f40 08300004 40009a00 0a008866 00001004 00000400 080c000c 03010200 03000004 00200400 00000201 c0000500 18068700 21800000 3040001c 00042000 e0000200 08040000 c0800181 00400180 01068013 a4040000 00022600 |