On Target NP_HCoV-OC43 0.28125/CHEMBL3233481
For the given ligand 617, we have found in our database that, being scored 0.28125, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| 617 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Cc1ccc(N)cc1C(=O)NC(C)c2cccc3ccccc23 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 10000002 00800800 00000100 10010600 00000000 00008000 00000000 02001000 00800000 00080840 08200004 40008000 00008802 00200000 00000440 10000000 00002000 02000000 00000000 00000000 c0020000 08028608 20000000 0040001c 00040000 c0000000 00004000 80000000 00400100 00060003 80040000 00000600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |