On Target NSP1_SARS 0.21985815/CHEMBL2441741
For the given ligand 617, we have found in our database that, being scored 0.21985815, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| 617 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| Cc1ccc(N)cc1C(=O)NC(C)c2cccc3ccccc23 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 10000002 00800800 00000100 10010600 00000000 00008000 00000000 02001000 00800000 00080840 08200004 40008000 00008802 00200000 00000440 10000000 00002000 02000000 00000000 00000000 c0020000 08028608 20000000 0040001c 00040000 c0000000 00004000 80000000 00400100 00060003 80040000 00000600 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |