On Target NS3_HCV1A 0.24260356/CHEMBL4110215
For the given ligand Ebselen, we have found in our database that, being scored 0.24260356, the most similar ligand is CHEMBL4110215. Check out the elaboration below.
| Ebselen (Given Ligand) | CHEMBL4110215 (Similar Ligand) |
|---|---|
| O=c2c1ccccc1sn2c3ccccc3 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2ccns2)c1F |
|
|
|
|
|
|
| 00018012 40200200 01002000 00000600 001c0000 00008020 04000002 00009100 06500000 410208c0 00000404 10058820 0200982c 00600000 00000040 0004000c 00000000 00100000 08200010 00001000 40000080 18008198 20800000 83700000 00002000 0c001004 00000000 00800000 04000000 20062008 00040000 01c10e00 | 00018050 00001800 00100100 02010600 00000201 00000010 20000080 01003101 00000800 00182e40 08100000 40808a20 0200886c 00001005 00000000 080c020c 03000a00 03000020 00000400 00004001 40000d01 18038b80 01800000 10400014 00002001 a4200200 08040000 40800081 00000080 2006a016 84044000 00830620 |