On Target NS3_HCV1A 0.21875/CHEMBL4110215
For the given ligand Tideglusib, we have found in our database that, being scored 0.21875, the most similar ligand is CHEMBL4110215. Check out the elaboration below.
| Tideglusib (Given Ligand) | CHEMBL4110215 (Similar Ligand) |
|---|---|
| O=c3sn(c1cccc2ccccc12)c(=O)n3Cc4ccccc4 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2ccns2)c1F |
|
|
|
|
|
|
| 00030022 00000000 0a020150 02210708 00100040 02018010 00008082 08009110 04400100 00002860 0c00040c 70018840 04008828 00400000 10041041 0008280c 48000000 02104000 00400018 00000000 40000080 1c808188 219000c0 81e00000 00004000 88102008 00808400 00040000 04040000 20064000 00040000 02811201 | 00018050 00001800 00100100 02010600 00000201 00000010 20000080 01003101 00000800 00182e40 08100000 40808a20 0200886c 00001005 00000000 080c020c 03000a00 03000020 00000400 00004001 40000d01 18038b80 01800000 10400014 00002001 a4200200 08040000 40800081 00000080 2006a016 84044000 00830620 |