On Target PA_INFA 0.22222222/CHEMBL463590
For the given ligand Tideglusib, we have found in our database that, being scored 0.22222222, the most similar ligand is CHEMBL463590. Check out the elaboration below.
| Tideglusib (Given Ligand) | CHEMBL463590 (Similar Ligand) |
|---|---|
| O=c3sn(c1cccc2ccccc12)c(=O)n3Cc4ccccc4 | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 00030022 00000000 0a020150 02210708 00100040 02018010 00008082 08009110 04400100 00002860 0c00040c 70018840 04008828 00400000 10041041 0008280c 48000000 02104000 00400018 00000000 40000080 1c808188 219000c0 81e00000 00004000 88102008 00808400 00040000 04040000 20064000 00040000 02811201 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 2a001400 01100800 001808c0 08300000 5001d800 86028826 00200000 00000400 00080008 00000000 02000000 00250018 00000201 00000100 18008b80 04008000 00500010 00003800 c0002400 00444000 90000000 00004100 00060002 24040000 00820600 |