On Target PR_HIV1 0.21078432/CHEMBL492666
For the given ligand Shikonin, we have found in our database that, being scored 0.21078432, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Shikonin (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| C/C(C)=C\CC(O)c2cc(=O)c1c(O)ccc(O)c1c2=O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00010000 43000c08 20000102 00010202 00010000 40828002 22001081 00000603 81040800 00988840 08100200 40409040 14028002 00200000 00000424 20082008 00000004 02100000 00712010 00020a01 00400100 080202c0 0100c040 00400014 00201000 84004401 00484000 80000000 00000002 00034002 a4000000 00000400 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |