On Target PR_HIV1 0.1826484/CHEMBL492666
For the given ligand Tideglusib, we have found in our database that, being scored 0.1826484, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Tideglusib (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| O=c3sn(c1cccc2ccccc12)c(=O)n3Cc4ccccc4 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00030022 00000000 0a020150 02210708 00100040 02018010 00008082 08009110 04400100 00002860 0c00040c 70018840 04008828 00400000 10041041 0008280c 48000000 02104000 00400018 00000000 40000080 1c808188 219000c0 81e00000 00004000 88102008 00808400 00040000 04040000 20064000 00040000 02811201 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |