On Target NS5B_HCV1A 0.35099337/CHEMBL446360
For the given ligand Shikonin, we have found in our database that, being scored 0.35099337, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| Shikonin (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| C/C(C)=C\CC(O)c2cc(=O)c1c(O)ccc(O)c1c2=O | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 00010000 43000c08 20000102 00010202 00010000 40828002 22001081 00000603 81040800 00988840 08100200 40409040 14028002 00200000 00000424 20082008 00000004 02100000 00712010 00020a01 00400100 080202c0 0100c040 00400014 00201000 84004401 00484000 80000000 00000002 00034002 a4000000 00000400 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |