On Target NS5B_HCV1B 0.21532847/CHEMBL3645202
For the given ligand Tideglusib, we have found in our database that, being scored 0.21532847, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| Tideglusib (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| O=c3sn(c1cccc2ccccc12)c(=O)n3Cc4ccccc4 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00030022 00000000 0a020150 02210708 00100040 02018010 00008082 08009110 04400100 00002860 0c00040c 70018840 04008828 00400000 10041041 0008280c 48000000 02104000 00400018 00000000 40000080 1c808188 219000c0 81e00000 00004000 88102008 00808400 00040000 04040000 20064000 00040000 02811201 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |