On Target NP_HCoV-OC43 0.264/CHEMBL3233481
For the given ligand Ebselen, we have found in our database that, being scored 0.264, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Ebselen (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| O=c2c1ccccc1sn2c3ccccc3 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00018012 40200200 01002000 00000600 001c0000 00008020 04000002 00009100 06500000 410208c0 00000404 10058820 0200982c 00600000 00000040 0004000c 00000000 00100000 08200010 00001000 40000080 18008198 20800000 83700000 00002000 0c001004 00000000 00800000 04000000 20062008 00040000 01c10e00 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |