On Target NP_HCoV-OC43 0.17419355/CHEMBL3233481
For the given ligand Tideglusib, we have found in our database that, being scored 0.17419355, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Tideglusib (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| O=c3sn(c1cccc2ccccc12)c(=O)n3Cc4ccccc4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00030022 00000000 0a020150 02210708 00100040 02018010 00008082 08009110 04400100 00002860 0c00040c 70018840 04008828 00400000 10041041 0008280c 48000000 02104000 00400018 00000000 40000080 1c808188 219000c0 81e00000 00004000 88102008 00808400 00040000 04040000 20064000 00040000 02811201 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |