On Target PLP_SARS 0.21111111/CHEMBL222893
For the given ligand Ebselen, we have found in our database that, being scored 0.21111111, the most similar ligand is CHEMBL222893. Check out the elaboration below.
| Ebselen (Given Ligand) | CHEMBL222893 (Similar Ligand) |
|---|---|
| O=c2c1ccccc1sn2c3ccccc3 | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2s1 |
|
|
|
|
|
|
| 00018012 40200200 01002000 00000600 001c0000 00008020 04000002 00009100 06500000 410208c0 00000404 10058820 0200982c 00600000 00000040 0004000c 00000000 00100000 08200010 00001000 40000080 18008198 20800000 83700000 00002000 0c001004 00000000 00800000 04000000 20062008 00040000 01c10e00 | 04018042 15000808 60004108 20010200 000c1040 04004084 80080080 01200000 00000100 00000840 00000204 40058880 0680881c 08010002 01032082 060c000c 09030000 02002008 00200008 00020010 40002060 48028ba8 30900080 10c09004 02002c02 84082200 00000200 80000004 00000200 00020000 c0000000 10c30400 |