On Target ACE2_HUMAN 0.078125/CHEMBL401086
For the given ligand sta2, we have found in our database that, being scored 0.078125, the most similar ligand is CHEMBL401086. Check out the elaboration below.
| sta2 (Given Ligand) | CHEMBL401086 (Similar Ligand) |
|---|---|
| CCC2CCC3CCCCCCCC(CC/C=C/CC1CC1)C23 | CC[C@@H](C)[C@H](S)C(=O)NCC(=O)O |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000402 00000000 00100000 00000000 40000000 00020000 01000000 00000400 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00008000 00000010 00200000 00000000 00404000 80000000 00000000 01000000 24020000 00000000 | 00010000 01004000 00100000 00100400 00000080 00000000 80000000 20000000 00000000 02080080 00200000 40013000 06008002 00040000 80080000 00080008 10000000 00000000 00000000 00000201 00000000 10000e00 02000100 04100018 00000000 00000000 00000000 10000040 00000000 00040001 20004000 03010200 |