On Target ACE2_HUMAN 0.37096775/CHEMBL254703
For the given ligand X3, we have found in our database that, being scored 0.37096775, the most similar ligand is CHEMBL254703. Check out the elaboration below.
| X3 (Given Ligand) | CHEMBL254703 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)O |
|
|
|
|
|
|
| 04000008 44000008 20000108 00210600 00001080 00004000 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00010080 01000401 02088008 10000000 02000000 00480000 00020200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000000 00000300 00060008 40040000 00000200 | 04010000 01005008 20100108 00110600 00001080 00004000 82040000 20000004 00000980 020a08c0 08300000 4001b000 06808002 00050000 81080001 02080008 10000000 02000000 00400008 00020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00120000 10000040 04000200 00060003 60004000 03012600 |