On Target NS5B_HCV1B 0.23376623/CHEMBL3645195
For the given ligand X3, we have found in our database that, being scored 0.23376623, the most similar ligand is CHEMBL3645195. Check out the elaboration below.
| X3 (Given Ligand) | CHEMBL3645195 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3ccnc(OC)c3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 04000008 44000008 20000108 00210600 00001080 00004000 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00010080 01000401 02088008 10000000 02000000 00480000 00020200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000000 00000300 00060008 40040000 00000200 | 00004006 4480de18 2018490a 41310e00 a10c1000 00004142 06040000 0200140c 00100900 004909e0 09312024 40118800 80008c33 01400201 a18a4541 201e200e 14268008 02000004 08680008 00225203 e0120101 1c8b8e38 2080c800 9364801c 02104080 c0000048 00270080 8000108c 0d488304 0046005b e4048088 ac1147e0 |