On Target NA_INFB 0.19774011/CHEMBL4161935
For the given ligand X3, we have found in our database that, being scored 0.19774011, the most similar ligand is CHEMBL4161935. Check out the elaboration below.
| X3 (Given Ligand) | CHEMBL4161935 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N(CC)CC)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 04000008 44000008 20000108 00210600 00001080 00004000 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00010080 01000401 02088008 10000000 02000000 00480000 00020200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000000 00000300 00060008 40040000 00000200 | 00074042 09007800 00100100 84010700 00180080 00000800 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00001448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |