On Target NS3_HCV1A 0.272/CHEMBL3945828
For the given ligand PY2-64, we have found in our database that, being scored 0.272, the most similar ligand is CHEMBL3945828. Check out the elaboration below.
| PY2-64 (Given Ligand) | CHEMBL3945828 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S(C)(=O)=O)c(-c3ccc4ccn5c6ccc(OC)nc6cc5c4n3)cc12 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 08402002 02a00819 2018490a 52310e02 8a8c1261 0000c110 06298010 42a8b200 10474100 10000840 0421a124 40308400 c0008c07 00e01081 e12e4b61 2216000c 18064000 12032800 0e600200 10524020 402e0000 3a028e2e 71800060 80480004 0800208c 80004000 04408054 888010cd 0040e304 01068c01 c0040a40 04010660 |