On Target NS3_HCV1A 0.35507247/CHEMBL3984600
For the given ligand PY1-61, we have found in our database that, being scored 0.35507247, the most similar ligand is CHEMBL3984600. Check out the elaboration below.
| PY1-61 (Given Ligand) | CHEMBL3984600 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(C(NC(=O)Cc1ccccc1)NC(=O)Cc2ccccc2)cc3 | CC[C@@H](N[C@@H](C)CC(N)=O)c1ccc(Cl)c(C(=O)c2ccc(N)c(C)c2)c1F |
|
|
|
|
|
|
| 00004002 01800800 00100100 80010e00 00000000 00000000 00000004 02003000 00000080 00080840 08200004 40009000 01009802 00008000 40000440 00000000 00040008 02000000 08000040 00000201 c0100100 18218600 20000000 81400018 00010000 c0000000 00000000 80000080 04008100 00060203 20042000 00000600 | 000080c2 00000c00 00100100 c2010600 00000201 00000010 30000000 03001000 00000800 00080fc0 08300004 40009a00 0e008866 00001004 00020440 08080008 03000200 03000000 00000410 00000201 40000500 18028700 21000000 30400014 00003000 e0000200 08040000 c0800081 00000180 00068012 a4040000 00022600 |