On Target ACE2_HUMAN 0.23493975/CHEMBL251804
For the given ligand PY2-64, we have found in our database that, being scored 0.23493975, the most similar ligand is CHEMBL251804. Check out the elaboration below.
| PY2-64 (Given Ligand) | CHEMBL251804 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1Oc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00010000 01005008 20100108 00118600 00001080 00000000 86000000 20000204 00000884 020a08c0 08300000 4001b0c0 06008002 00040000 81080001 00082008 90000000 02000000 00402008 00020201 00400100 18200e00 03000140 85500418 00000800 c0000000 00000000 10200040 04000300 00070003 20024400 03012600 |