On Target ACE2_HUMAN 0.3697479/CHEMBL437595
For the given ligand PY1-61, we have found in our database that, being scored 0.3697479, the most similar ligand is CHEMBL437595. Check out the elaboration below.
| PY1-61 (Given Ligand) | CHEMBL437595 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(C(NC(=O)Cc1ccccc1)NC(=O)Cc2ccccc2)cc3 | O=C(O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)[C@@H](S)c1ccccc1 |
|
|
|
|
|
|
| 00004002 01800800 00100100 80010e00 00000000 00000000 00000004 02003000 00000080 00080840 08200004 40009000 01009802 00008000 40000440 00000000 00040008 02000000 08000040 00000201 c0100100 18218600 20000000 81400018 00010000 c0000000 00000000 80000080 04008100 00060203 20042000 00000600 | 00002000 00005000 00102100 00110600 00000080 00000000 80000000 00000004 00000980 020a0840 08300000 4000b800 07009002 00040000 c0080000 00080008 10020008 02000100 04400008 10000201 00000100 18200e00 13000040 85400018 00000800 80000000 00000000 00000040 04004000 00060003 20006000 02012600 |