On Target NS5B_HCV1A 0.30769232/CHEMBL3644925
For the given ligand PY1-61, we have found in our database that, being scored 0.30769232, the most similar ligand is CHEMBL3644925. Check out the elaboration below.
| PY1-61 (Given Ligand) | CHEMBL3644925 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(C(NC(=O)Cc1ccccc1)NC(=O)Cc2ccccc2)cc3 | CCC[C@H](NC(=O)[C@@H]1CN(c2ccc(-c3ccccc3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00004002 01800800 00100100 80010e00 00000000 00000000 00000004 02003000 00000080 00080840 08200004 40009000 01009802 00008000 40000440 00000000 00040008 02000000 08000040 00000201 c0100100 18218600 20000000 81400018 00010000 c0000000 00000000 80000080 04008100 00060203 20042000 00000600 | 00016006 01403c00 00100120 04010f00 20080000 00018000 00000004 a0002009 04800200 00020be0 00200004 5001b000 0e00b00a 0100a101 80020040 001a0008 00860010 02482001 0c402850 00000a01 60100100 380f0e10 31020003 0250001a 00113000 80001002 00000000 102000e0 0800c200 01060013 a0184000 00006200 |