On Target NP_HCoV-OC43 0.18978103/CHEMBL3233481
For the given ligand PY2-64, we have found in our database that, being scored 0.18978103, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| PY2-64 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |