On Target NS3_HCV1A 0.3773585/CHEMBL3898519
For the given ligand Imatinib, we have found in our database that, being scored 0.3773585, the most similar ligand is CHEMBL3898519. Check out the elaboration below.
| Imatinib (Given Ligand) | CHEMBL3898519 (Similar Ligand) |
|---|---|
| Cc3ccc(NC(=O)c2ccc(CN1CCN(C)CC1)cc2)cc3Nc5nccc(c4cccnc4)n5 | CC(C)c1ccc2c(Nc3cc(C(=O)Nc4ccc(-c5c[nH]c([C@@H]6CCCN6C(=O)[C@@H](c6ccccc6)N(C)C)n5)cc4)ccc3Sc3ccc(N)cc3)ncnc2n1 |
|
|
|
|
|
|
| 0001e202 00010800 80004100 44050610 09041004 04004000 00002800 02081000 00000100 00010840 00280004 6000d810 82008802 0010a000 00020440 800c0004 00060000 12006004 0c600000 10a00006 40100000 2c02a600 31812860 0240011c 000c0003 c0180000 08000600 800110e0 08c0810c 00460801 c0040800 200002a2 | 1000c00a 01803a00 001a4d00 1c190e10 04040060 0810601a 01409010 22083841 10802180 000808d0 08399004 6081f800 07008882 0891a000 40020040 9a0c0106 04069000 76006023 0c60000a 52200a01 c1300000 382f8660 21816041 8358001f 00144001 80080200 022082d8 908010c0 2c41c30c 01e60803 c004e8a0 200126e0 |