On Target ACE2_HUMAN 0.23195876/CHEMBL401397
For the given ligand Eltrombopag, we have found in our database that, being scored 0.23195876, the most similar ligand is CHEMBL401397. Check out the elaboration below.
| Eltrombopag (Given Ligand) | CHEMBL401397 (Similar Ligand) |
|---|---|
| Cc4ccc(n3nc(C)c(=NNc2cccc(c1cccc(C(=O)O)c1)c2O)c3=O)cc4C | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc(-c2ccccc2)c1)C(=O)O |
|
|
|
|
|
|
| 01b26006 00000808 603a0180 20031600 24000005 04006440 12001801 21004002 02008180 200008d1 002b000c 40009000 05408002 00308000 00820240 28086008 00060040 02001000 0c000400 40220a03 c0180000 1c020e21 f0002800 00604014 00040000 88480002 50000200 500000c1 1041c000 000e0003 c0200202 00000200 | 00012000 01005000 00100100 00110600 00001081 00000000 80000000 20000004 00000880 020a08c0 08300000 4001b000 06008002 00040000 80080000 00080008 10020000 02001000 04400008 00000201 00000100 18200e00 13000140 85500018 00000800 80000080 00000000 10000041 04004000 00060003 20004000 03012600 |