On Target RDRP_SARS2 0.2/CHEMBL4065616
For the given ligand Imatinib, we have found in our database that, being scored 0.2, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| Imatinib (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| Cc3ccc(NC(=O)c2ccc(CN1CCN(C)CC1)cc2)cc3Nc5nccc(c4cccnc4)n5 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 0001e202 00010800 80004100 44050610 09041004 04004000 00002800 02081000 00000100 00010840 00280004 6000d810 82008802 0010a000 00020440 800c0004 00060000 12006004 0c600000 10a00006 40100000 2c02a600 31812860 0240011c 000c0003 c0180000 08000600 800110e0 08c0810c 00460801 c0040800 200002a2 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |