On Target NSP15_SARS 0.16363636/CHEMBL1092796
For the given ligand Proscillaridin, we have found in our database that, being scored 0.16363636, the most similar ligand is CHEMBL1092796. Check out the elaboration below.
| Proscillaridin (Given Ligand) | CHEMBL1092796 (Similar Ligand) |
|---|---|
| C[C@@H]6O[C@@H](O[C@@H]5/C=C\4CC[C@@H]2[C@H](CC[C@]3(C)[C@@H](c1ccc(=O)oc1)CC[C@]23O)[C@@]4(C)CC5)[C@H](O)[C@H](O)[C@H]6O | CC1=CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
|
|
|
|
|
|
| 00040040 01200000 00080102 00810300 80280151 00c00900 02006800 08000402 02204800 41180068 40100020 48408000 48028400 02a00080 00000480 102a9008 00800020 02000020 3340a010 00000001 00100120 0a000000 0500c048 08580010 00201450 80004401 00404010 ae900021 62002202 01020002 24a20000 00000410 | 00000402 01040000 00000800 00080000 40402000 00000001 00000080 02000402 01000000 00100000 00000200 40404200 80028000 20000000 00000404 0008040c 00000000 00000020 02092080 00020001 00002001 00000280 01008000 00000812 00200000 00000000 00404240 80800000 00004000 00000000 24820000 04000000 |