On Target NSP15_SARS 0.2112676/CHEMBL3105073
For the given ligand Imatinib, we have found in our database that, being scored 0.2112676, the most similar ligand is CHEMBL3105073. Check out the elaboration below.
| Imatinib (Given Ligand) | CHEMBL3105073 (Similar Ligand) |
|---|---|
| Cc3ccc(NC(=O)c2ccc(CN1CCN(C)CC1)cc2)cc3Nc5nccc(c4cccnc4)n5 | S=C(NCc1cccnc1)SCc1cc(Cl)sc1Cl |
|
|
|
|
|
|
| 0001e202 00010800 80004100 44050610 09041004 04004000 00002800 02081000 00000100 00010840 00280004 6000d810 82008802 0010a000 00020440 800c0004 00060000 12006004 0c600000 10a00006 40100000 2c02a600 31812860 0240011c 000c0003 c0180000 08000600 800110e0 08c0810c 00460801 c0040800 200002a2 | 10018012 00008008 10006d00 01100610 20149004 00404084 04024000 22001000 00000001 03404040 01200204 40200880 0200180c 000c0001 80001000 00040104 04000400 02000304 00200000 01040208 40100000 48008981 20880020 02400000 05040000 04000200 28000400 a0020404 03603100 00060000 00000011 81c30288 |