On Target PLP_SARS 0.2835821/CHEMBL358279
For the given ligand Eltrombopag, we have found in our database that, being scored 0.2835821, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Eltrombopag (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| Cc4ccc(n3nc(C)c(=NNc2cccc(c1cccc(C(=O)O)c1)c2O)c3=O)cc4C | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 01b26006 00000808 603a0180 20031600 24000005 04006440 12001801 21004002 02008180 200008d1 002b000c 40009000 05408002 00308000 00820240 28086008 00060040 02001000 0c000400 40220a03 c0180000 1c020e21 f0002800 00604014 00040000 88480002 50000200 500000c1 1041c000 000e0003 c0200202 00000200 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |