On Target NS3_HCV1A 0.41947564/CHEMBL3892606
For the given ligand Conivaptan, we have found in our database that, being scored 0.41947564, the most similar ligand is CHEMBL3892606. Check out the elaboration below.
| Conivaptan (Given Ligand) | CHEMBL3892606 (Similar Ligand) |
|---|---|
| Cc6nc5c1ccccc1N(C(=O)c4ccc(NC(=O)c2ccccc2c3ccccc3)cc4)CCc5[nH]6 | CC(C)c1ccc2c(Nc3cc(C(=O)Nc4ccc(-c5c[nH]c([C@@H]6CCCN6C(=O)Cc6ccccc6)n5)cc4)ccc3Sc3ccc(N)cc3)ncnc2n1 |
|
|
|
|
|
|
| 0c00e202 00001801 00110100 91010e10 24000060 00008048 00002000 0208304c 00400180 10090a50 20298104 4000c800 03008802 00308001 a1020440 800c0006 04268200 1a002000 0c002000 40400200 44120800 18228600 31016020 1044001d 10841001 c1080280 00000210 800050c0 0401c104 03660c01 e0040820 20000200 | 1000c00a 01803a00 001a4d00 18190e10 04040060 0810601a 01409010 22083841 10802180 000808d0 08399004 6081d800 07008882 08918000 40020040 9a0c0106 04069000 76006023 0c60000a 52200a01 c1300000 182f8660 21816040 8158001f 00144001 80080200 022082d8 908010c0 2441c30c 01e60803 c004a8a0 200126e0 |